About butanedioic acid;ethyl prop-2-enoate
butanedioic acid;ethyl prop-2-enoate (PubChem CID 87191890) has the molecular formula C9H14O6
and a molecular weight of 218.20 g/mol. Its IUPAC name is butanedioic acid;ethyl prop-2-enoate.
Molecular Properties
| Compound Name | butanedioic acid;ethyl prop-2-enoate |
| PubChem CID | 87191890 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | butanedioic acid;ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCC.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C5H8O2.C4H6O4/c1-3-5(6)7-4-2;5-3(6)1-2-4(7)8/h3H,1,4H2,2H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | ICYKOYDTQVUPFB-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butanedioic acid;ethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedioic acid;ethyl prop-2-enoate?
The IUPAC name of butanedioic acid;ethyl prop-2-enoate (CID 87191890) is butanedioic acid;ethyl prop-2-enoate.
What is the SMILES notation for butanedioic acid;ethyl prop-2-enoate?
The canonical SMILES for butanedioic acid;ethyl prop-2-enoate is C=CC(=O)OCC.O=C(O)CCC(=O)O.
What is the InChIKey of butanedioic acid;ethyl prop-2-enoate?
The InChIKey is ICYKOYDTQVUPFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.C4H6O4/c1-3-5(6)7-4-2;5-3(6)1-2-4(7)8/h3H,1,4H2,2H3;1-2H2,(H,5,6)(H,7,8).
What are the key properties of butanedioic acid;ethyl prop-2-enoate?
butanedioic acid;ethyl prop-2-enoate has a molecular weight of 218.20 g/mol, XLogP of 0.67, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butanedioic acid;ethyl prop-2-enoate is sourced from PubChem (CID 87191890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).