C19H26N6S — CID 87191937
N-cyclohexyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-4,7-diazaspiro[2.5]octane-4-carbothioamide (PubChem CID 87191937) has the molecular formula C19H26N6S and a molecular weight of 370.53 g/mol. Its IUPAC name is N-cyclohexyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-4,7-diazaspiro[2.5]octane-4-carbothioamide.
| Compound Name | N-cyclohexyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-4,7-diazaspiro[2.5]octane-4-carbothioamide |
|---|---|
| PubChem CID | 87191937 |
| Molecular Formula | C19H26N6S |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | N-cyclohexyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-4,7-diazaspiro[2.5]octane-4-carbothioamide |
| SMILES | S=C(NC1CCCCC1)N1CCN(c2ncnc3[nH]ccc23)CC12CC2 |
| InChI | InChI=1S/C19H26N6S/c26-18(23-14-4-2-1-3-5-14)25-11-10-24(12-19(25)7-8-19)17-15-6-9-20-16(15)21-13-22-17/h6,9,13-14H,1-5,7-8,10-12H2,(H,23,26)(H,20,21,22) |
| InChIKey | OTFWHYAUGAUHMJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|