About (3-hydroxy-1-adamantyl)methyl 2,3-difluoro-3-(triphenyl-λ4-sulfanyl)propanoate
(3-hydroxy-1-adamantyl)methyl 2,3-difluoro-3-(triphenyl-λ4-sulfanyl)propanoate (PubChem CID 87192094) has the molecular formula C32H34F2O3S
and a molecular weight of 536.68 g/mol. Its IUPAC name is (3-hydroxy-1-adamantyl)methyl 2,3-difluoro-3-(triphenyl-λ4-sulfanyl)propanoate.
Molecular Properties
| Compound Name | (3-hydroxy-1-adamantyl)methyl 2,3-difluoro-3-(triphenyl-λ4-sulfanyl)propanoate |
| PubChem CID | 87192094 |
| Molecular Formula | C32H34F2O3S |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | (3-hydroxy-1-adamantyl)methyl 2,3-difluoro-3-(triphenyl-λ4-sulfanyl)propanoate |
| SMILES | O=C(OCC12CC3CC(CC(O)(C3)C1)C2)C(F)C(F)S(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H34F2O3S/c33-28(30(35)37-22-31-17-23-16-24(18-31)20-32(36,19-23)21-31)29(34)38(25-10-4-1-5-11-25,26-12-6-2-7-13-26)27-14-8-3-9-15-27/h1-15,23-24,28-29,36H,16-22H2 |
| InChIKey | CHLINNKQGVPWRR-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-hydroxy-1-adamantyl)methyl 2,3-difluoro-3-(triphenyl-λ4-sulfanyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-1-adamantyl)methyl 2,3-difluoro-3-(triphenyl-λ4-sulfanyl)propanoate?
The IUPAC name of (3-hydroxy-1-adamantyl)methyl 2,3-difluoro-3-(triphenyl-λ4-sulfanyl)propanoate (CID 87192094) is (3-hydroxy-1-adamantyl)methyl 2,3-difluoro-3-(triphenyl-λ4-sulfanyl)propanoate.
What is the SMILES notation for (3-hydroxy-1-adamantyl)methyl 2,3-difluoro-3-(triphenyl-λ4-sulfanyl)propanoate?
The canonical SMILES for (3-hydroxy-1-adamantyl)methyl 2,3-difluoro-3-(triphenyl-λ4-sulfanyl)propanoate is O=C(OCC12CC3CC(CC(O)(C3)C1)C2)C(F)C(F)S(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of (3-hydroxy-1-adamantyl)methyl 2,3-difluoro-3-(triphenyl-λ4-sulfanyl)propanoate?
The InChIKey is CHLINNKQGVPWRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H34F2O3S/c33-28(30(35)37-22-31-17-23-16-24(18-31)20-32(36,19-23)21-31)29(34)38(25-10-4-1-5-11-25,26-12-6-2-7-13-26)27-14-8-3-9-15-27/h1-15,23-24,28-29,36H,16-22H2.
What are the key properties of (3-hydroxy-1-adamantyl)methyl 2,3-difluoro-3-(triphenyl-λ4-sulfanyl)propanoate?
(3-hydroxy-1-adamantyl)methyl 2,3-difluoro-3-(triphenyl-λ4-sulfanyl)propanoate has a molecular weight of 536.68 g/mol, XLogP of 7.48, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-1-adamantyl)methyl 2,3-difluoro-3-(triphenyl-λ4-sulfanyl)propanoate is sourced from PubChem (CID 87192094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).