C28H30ClN5O4S — CID 87192210
tert-butyl 4-[[4-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-3-yl]-6-chloro-2-pyridinyl]amino]piperidine-1-carboxylate (PubChem CID 87192210) has the molecular formula C28H30ClN5O4S and a molecular weight of 568.10 g/mol. Its IUPAC name is tert-butyl 4-[[4-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-3-yl]-6-chloro-2-pyridinyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-3-yl]-6-chloro-2-pyridinyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87192210 |
| Molecular Formula | C28H30ClN5O4S |
| Molecular Weight | 568.10 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | tert-butyl 4-[[4-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-3-yl]-6-chloro-2-pyridinyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2cc(-c3cn(S(=O)(=O)c4ccccc4)c4ncccc34)cc(Cl)n2)CC1 |
| InChI | InChI=1S/C28H30ClN5O4S/c1-28(2,3)38-27(35)33-14-11-20(12-15-33)31-25-17-19(16-24(29)32-25)23-18-34(26-22(23)10-7-13-30-26)39(36,37)21-8-5-4-6-9-21/h4-10,13,16-18,20H,11-12,14-15H2,1-3H3,(H,31,32) |
| InChIKey | WFBPAENVRHQXJP-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.10 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|