About 1,2-di(cyclohexylidene)hexane-1,6-diamine
1,2-di(cyclohexylidene)hexane-1,6-diamine (PubChem CID 87192238) has the molecular formula C18H32N2
and a molecular weight of 276.47 g/mol. Its IUPAC name is 1,2-di(cyclohexylidene)hexane-1,6-diamine.
Molecular Properties
| Compound Name | 1,2-di(cyclohexylidene)hexane-1,6-diamine |
| PubChem CID | 87192238 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | 1,2-di(cyclohexylidene)hexane-1,6-diamine |
| SMILES | NCCCCC(=C1CCCCC1)C(N)=C1CCCCC1 |
| InChI | InChI=1S/C18H32N2/c19-14-8-7-13-17(15-9-3-1-4-10-15)18(20)16-11-5-2-6-12-16/h1-14,19-20H2 |
| InChIKey | XTSFLUOCGQUUQG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,2-di(cyclohexylidene)hexane-1,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-di(cyclohexylidene)hexane-1,6-diamine?
The IUPAC name of 1,2-di(cyclohexylidene)hexane-1,6-diamine (CID 87192238) is 1,2-di(cyclohexylidene)hexane-1,6-diamine.
What is the SMILES notation for 1,2-di(cyclohexylidene)hexane-1,6-diamine?
The canonical SMILES for 1,2-di(cyclohexylidene)hexane-1,6-diamine is NCCCCC(=C1CCCCC1)C(N)=C1CCCCC1.
What is the InChIKey of 1,2-di(cyclohexylidene)hexane-1,6-diamine?
The InChIKey is XTSFLUOCGQUUQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N2/c19-14-8-7-13-17(15-9-3-1-4-10-15)18(20)16-11-5-2-6-12-16/h1-14,19-20H2.
What are the key properties of 1,2-di(cyclohexylidene)hexane-1,6-diamine?
1,2-di(cyclohexylidene)hexane-1,6-diamine has a molecular weight of 276.47 g/mol, XLogP of 4.55, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-di(cyclohexylidene)hexane-1,6-diamine is sourced from PubChem (CID 87192238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).