About methyl-tris(1,2,2-trifluoroethoxy)silane
methyl-tris(1,2,2-trifluoroethoxy)silane (PubChem CID 87192257) has the molecular formula C7H9F9O3Si
and a molecular weight of 340.21 g/mol. Its IUPAC name is methyl-tris(1,2,2-trifluoroethoxy)silane.
Molecular Properties
| Compound Name | methyl-tris(1,2,2-trifluoroethoxy)silane |
| PubChem CID | 87192257 |
| Molecular Formula | C7H9F9O3Si |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | methyl-tris(1,2,2-trifluoroethoxy)silane |
| SMILES | C[Si](OC(F)C(F)F)(OC(F)C(F)F)OC(F)C(F)F |
| InChI | InChI=1S/C7H9F9O3Si/c1-20(17-5(14)2(8)9,18-6(15)3(10)11)19-7(16)4(12)13/h2-7H,1H3 |
| InChIKey | ASTOIAHPKVCVNU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl-tris(1,2,2-trifluoroethoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-tris(1,2,2-trifluoroethoxy)silane?
The IUPAC name of methyl-tris(1,2,2-trifluoroethoxy)silane (CID 87192257) is methyl-tris(1,2,2-trifluoroethoxy)silane.
What is the SMILES notation for methyl-tris(1,2,2-trifluoroethoxy)silane?
The canonical SMILES for methyl-tris(1,2,2-trifluoroethoxy)silane is C[Si](OC(F)C(F)F)(OC(F)C(F)F)OC(F)C(F)F.
What is the InChIKey of methyl-tris(1,2,2-trifluoroethoxy)silane?
The InChIKey is ASTOIAHPKVCVNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F9O3Si/c1-20(17-5(14)2(8)9,18-6(15)3(10)11)19-7(16)4(12)13/h2-7H,1H3.
What are the key properties of methyl-tris(1,2,2-trifluoroethoxy)silane?
methyl-tris(1,2,2-trifluoroethoxy)silane has a molecular weight of 340.21 g/mol, XLogP of 3.29, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-tris(1,2,2-trifluoroethoxy)silane is sourced from PubChem (CID 87192257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).