C33H29ClN6O4S2 — CID 87192311
4-[1-(benzenesulfonyl)-5-[1-(benzenesulfonyl)pyrazol-4-yl]pyrrolo[2,3-b]pyridin-3-yl]-6-chloro-N-cyclohexylpyridin-2-amine (PubChem CID 87192311) has the molecular formula C33H29ClN6O4S2 and a molecular weight of 673.22 g/mol. Its IUPAC name is 4-[1-(benzenesulfonyl)-5-[1-(benzenesulfonyl)pyrazol-4-yl]pyrrolo[2,3-b]pyridin-3-yl]-6-chloro-N-cyclohexylpyridin-2-amine.
| Compound Name | 4-[1-(benzenesulfonyl)-5-[1-(benzenesulfonyl)pyrazol-4-yl]pyrrolo[2,3-b]pyridin-3-yl]-6-chloro-N-cyclohexylpyridin-2-amine |
|---|---|
| PubChem CID | 87192311 |
| Molecular Formula | C33H29ClN6O4S2 |
| Molecular Weight | 673.22 g/mol |
| Exact Mass | 672.14 |
| IUPAC Name | 4-[1-(benzenesulfonyl)-5-[1-(benzenesulfonyl)pyrazol-4-yl]pyrrolo[2,3-b]pyridin-3-yl]-6-chloro-N-cyclohexylpyridin-2-amine |
| SMILES | O=S(=O)(c1ccccc1)n1cc(-c2cnc3c(c2)c(-c2cc(Cl)nc(NC4CCCCC4)c2)cn3S(=O)(=O)c2ccccc2)cn1 |
| InChI | InChI=1S/C33H29ClN6O4S2/c34-31-17-23(18-32(38-31)37-26-10-4-1-5-11-26)30-22-39(45(41,42)27-12-6-2-7-13-27)33-29(30)16-24(19-35-33)25-20-36-40(21-25)46(43,44)28-14-8-3-9-15-28/h2-3,6-9,12-22,26H,1,4-5,10-11H2,(H,37,38) |
| InChIKey | QGINWKJTXDTBES-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.22 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|