About 4-amino-3-methoxy-2,5-dimethylbenzaldehyde
4-amino-3-methoxy-2,5-dimethylbenzaldehyde (PubChem CID 87192325) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 4-amino-3-methoxy-2,5-dimethylbenzaldehyde.
Molecular Properties
| Compound Name | 4-amino-3-methoxy-2,5-dimethylbenzaldehyde |
| PubChem CID | 87192325 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 4-amino-3-methoxy-2,5-dimethylbenzaldehyde |
| SMILES | COc1c(C)c(C=O)cc(C)c1N |
| InChI | InChI=1S/C10H13NO2/c1-6-4-8(5-12)7(2)10(13-3)9(6)11/h4-5H,11H2,1-3H3 |
| InChIKey | GANYAYNOWLOWQE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3-methoxy-2,5-dimethylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-methoxy-2,5-dimethylbenzaldehyde?
The IUPAC name of 4-amino-3-methoxy-2,5-dimethylbenzaldehyde (CID 87192325) is 4-amino-3-methoxy-2,5-dimethylbenzaldehyde.
What is the SMILES notation for 4-amino-3-methoxy-2,5-dimethylbenzaldehyde?
The canonical SMILES for 4-amino-3-methoxy-2,5-dimethylbenzaldehyde is COc1c(C)c(C=O)cc(C)c1N.
What is the InChIKey of 4-amino-3-methoxy-2,5-dimethylbenzaldehyde?
The InChIKey is GANYAYNOWLOWQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-6-4-8(5-12)7(2)10(13-3)9(6)11/h4-5H,11H2,1-3H3.
What are the key properties of 4-amino-3-methoxy-2,5-dimethylbenzaldehyde?
4-amino-3-methoxy-2,5-dimethylbenzaldehyde has a molecular weight of 179.22 g/mol, XLogP of 1.71, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-methoxy-2,5-dimethylbenzaldehyde is sourced from PubChem (CID 87192325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).