C32H37ClN6O2 — CID 87192357
benzyl N-[4-[[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]amino]cyclohexyl]carbamate (PubChem CID 87192357) has the molecular formula C32H37ClN6O2 and a molecular weight of 573.14 g/mol. Its IUPAC name is benzyl N-[4-[[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]amino]cyclohexyl]carbamate.
| Compound Name | benzyl N-[4-[[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 87192357 |
| Molecular Formula | C32H37ClN6O2 |
| Molecular Weight | 573.14 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | benzyl N-[4-[[4-[[6-chloro-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]amino]cyclohexyl]amino]cyclohexyl]carbamate |
| SMILES | O=C(NC1CCC(NC2CCC(Nc3cc(-c4c[nH]c5ncccc45)cc(Cl)n3)CC2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C32H37ClN6O2/c33-29-17-22(28-19-35-31-27(28)7-4-16-34-31)18-30(39-29)37-25-12-8-23(9-13-25)36-24-10-14-26(15-11-24)38-32(40)41-20-21-5-2-1-3-6-21/h1-7,16-19,23-26,36H,8-15,20H2,(H,34,35)(H,37,39)(H,38,40) |
| InChIKey | SANDEOCGMZZXCB-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 103.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.14 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|