About dimethyl-bis(1,2,2-trifluoroethoxy)silane
dimethyl-bis(1,2,2-trifluoroethoxy)silane (PubChem CID 87192406) has the molecular formula C6H10F6O2Si
and a molecular weight of 256.22 g/mol. Its IUPAC name is dimethyl-bis(1,2,2-trifluoroethoxy)silane.
Molecular Properties
| Compound Name | dimethyl-bis(1,2,2-trifluoroethoxy)silane |
| PubChem CID | 87192406 |
| Molecular Formula | C6H10F6O2Si |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | dimethyl-bis(1,2,2-trifluoroethoxy)silane |
| SMILES | C[Si](C)(OC(F)C(F)F)OC(F)C(F)F |
| InChI | InChI=1S/C6H10F6O2Si/c1-15(2,13-5(11)3(7)8)14-6(12)4(9)10/h3-6H,1-2H3 |
| InChIKey | GJDZRGPFKYQBDW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-bis(1,2,2-trifluoroethoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-bis(1,2,2-trifluoroethoxy)silane?
The IUPAC name of dimethyl-bis(1,2,2-trifluoroethoxy)silane (CID 87192406) is dimethyl-bis(1,2,2-trifluoroethoxy)silane.
What is the SMILES notation for dimethyl-bis(1,2,2-trifluoroethoxy)silane?
The canonical SMILES for dimethyl-bis(1,2,2-trifluoroethoxy)silane is C[Si](C)(OC(F)C(F)F)OC(F)C(F)F.
What is the InChIKey of dimethyl-bis(1,2,2-trifluoroethoxy)silane?
The InChIKey is GJDZRGPFKYQBDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F6O2Si/c1-15(2,13-5(11)3(7)8)14-6(12)4(9)10/h3-6H,1-2H3.
What are the key properties of dimethyl-bis(1,2,2-trifluoroethoxy)silane?
dimethyl-bis(1,2,2-trifluoroethoxy)silane has a molecular weight of 256.22 g/mol, XLogP of 2.84, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-bis(1,2,2-trifluoroethoxy)silane is sourced from PubChem (CID 87192406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).