About tetrakis(2,3,3-trifluoropropyl)silane
tetrakis(2,3,3-trifluoropropyl)silane (PubChem CID 87192485) has the molecular formula C12H16F12Si
and a molecular weight of 416.32 g/mol. Its IUPAC name is tetrakis(2,3,3-trifluoropropyl)silane.
Molecular Properties
| Compound Name | tetrakis(2,3,3-trifluoropropyl)silane |
| PubChem CID | 87192485 |
| Molecular Formula | C12H16F12Si |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | tetrakis(2,3,3-trifluoropropyl)silane |
| SMILES | FC(F)C(F)C[Si](CC(F)C(F)F)(CC(F)C(F)F)CC(F)C(F)F |
| InChI | InChI=1S/C12H16F12Si/c13-5(9(17)18)1-25(2-6(14)10(19)20,3-7(15)11(21)22)4-8(16)12(23)24/h5-12H,1-4H2 |
| InChIKey | ZMIBMJDRDYPKJW-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tetrakis(2,3,3-trifluoropropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrakis(2,3,3-trifluoropropyl)silane?
The IUPAC name of tetrakis(2,3,3-trifluoropropyl)silane (CID 87192485) is tetrakis(2,3,3-trifluoropropyl)silane.
What is the SMILES notation for tetrakis(2,3,3-trifluoropropyl)silane?
The canonical SMILES for tetrakis(2,3,3-trifluoropropyl)silane is FC(F)C(F)C[Si](CC(F)C(F)F)(CC(F)C(F)F)CC(F)C(F)F.
What is the InChIKey of tetrakis(2,3,3-trifluoropropyl)silane?
The InChIKey is ZMIBMJDRDYPKJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F12Si/c13-5(9(17)18)1-25(2-6(14)10(19)20,3-7(15)11(21)22)4-8(16)12(23)24/h5-12H,1-4H2.
What are the key properties of tetrakis(2,3,3-trifluoropropyl)silane?
tetrakis(2,3,3-trifluoropropyl)silane has a molecular weight of 416.32 g/mol, XLogP of 5.85, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrakis(2,3,3-trifluoropropyl)silane is sourced from PubChem (CID 87192485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).