C30H28ClN5O4S2 — CID 87192609
4-[1-(benzenesulfonyl)-3-[2-chloro-6-(cyclohexylamino)-4-pyridinyl]pyrrolo[2,3-b]pyridin-5-yl]benzenesulfonamide (PubChem CID 87192609) has the molecular formula C30H28ClN5O4S2 and a molecular weight of 622.17 g/mol. Its IUPAC name is 4-[1-(benzenesulfonyl)-3-[2-chloro-6-(cyclohexylamino)-4-pyridinyl]pyrrolo[2,3-b]pyridin-5-yl]benzenesulfonamide.
| Compound Name | 4-[1-(benzenesulfonyl)-3-[2-chloro-6-(cyclohexylamino)-4-pyridinyl]pyrrolo[2,3-b]pyridin-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 87192609 |
| Molecular Formula | C30H28ClN5O4S2 |
| Molecular Weight | 622.17 g/mol |
| Exact Mass | 621.13 |
| IUPAC Name | 4-[1-(benzenesulfonyl)-3-[2-chloro-6-(cyclohexylamino)-4-pyridinyl]pyrrolo[2,3-b]pyridin-5-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2cnc3c(c2)c(-c2cc(Cl)nc(NC4CCCCC4)c2)cn3S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H28ClN5O4S2/c31-28-16-21(17-29(35-28)34-23-7-3-1-4-8-23)27-19-36(42(39,40)25-9-5-2-6-10-25)30-26(27)15-22(18-33-30)20-11-13-24(14-12-20)41(32,37)38/h2,5-6,9-19,23H,1,3-4,7-8H2,(H,34,35)(H2,32,37,38) |
| InChIKey | KGBYBLYJXKTGJB-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 137.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.17 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|