About 1,1-dicyclohexyl-3-(5-pentylsulfanyl-1,3-thiazol-2-yl)urea
1,1-dicyclohexyl-3-(5-pentylsulfanyl-1,3-thiazol-2-yl)urea (PubChem CID 87192872) has the molecular formula C21H35N3OS2
and a molecular weight of 409.67 g/mol. Its IUPAC name is 1,1-dicyclohexyl-3-(5-pentylsulfanyl-1,3-thiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1,1-dicyclohexyl-3-(5-pentylsulfanyl-1,3-thiazol-2-yl)urea |
| PubChem CID | 87192872 |
| Molecular Formula | C21H35N3OS2 |
| Molecular Weight | 409.67 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 1,1-dicyclohexyl-3-(5-pentylsulfanyl-1,3-thiazol-2-yl)urea |
| SMILES | CCCCCSc1cnc(NC(=O)N(C2CCCCC2)C2CCCCC2)s1 |
| InChI | InChI=1S/C21H35N3OS2/c1-2-3-10-15-26-19-16-22-20(27-19)23-21(25)24(17-11-6-4-7-12-17)18-13-8-5-9-14-18/h16-18H,2-15H2,1H3,(H,22,23,25) |
| InChIKey | WRUIWLDYVWWUDG-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.67 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dicyclohexyl-3-(5-pentylsulfanyl-1,3-thiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dicyclohexyl-3-(5-pentylsulfanyl-1,3-thiazol-2-yl)urea?
The IUPAC name of 1,1-dicyclohexyl-3-(5-pentylsulfanyl-1,3-thiazol-2-yl)urea (CID 87192872) is 1,1-dicyclohexyl-3-(5-pentylsulfanyl-1,3-thiazol-2-yl)urea.
What is the SMILES notation for 1,1-dicyclohexyl-3-(5-pentylsulfanyl-1,3-thiazol-2-yl)urea?
The canonical SMILES for 1,1-dicyclohexyl-3-(5-pentylsulfanyl-1,3-thiazol-2-yl)urea is CCCCCSc1cnc(NC(=O)N(C2CCCCC2)C2CCCCC2)s1.
What is the InChIKey of 1,1-dicyclohexyl-3-(5-pentylsulfanyl-1,3-thiazol-2-yl)urea?
The InChIKey is WRUIWLDYVWWUDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H35N3OS2/c1-2-3-10-15-26-19-16-22-20(27-19)23-21(25)24(17-11-6-4-7-12-17)18-13-8-5-9-14-18/h16-18H,2-15H2,1H3,(H,22,23,25).
What are the key properties of 1,1-dicyclohexyl-3-(5-pentylsulfanyl-1,3-thiazol-2-yl)urea?
1,1-dicyclohexyl-3-(5-pentylsulfanyl-1,3-thiazol-2-yl)urea has a molecular weight of 409.67 g/mol, XLogP of 6.92, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dicyclohexyl-3-(5-pentylsulfanyl-1,3-thiazol-2-yl)urea is sourced from PubChem (CID 87192872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).