C20H20N4O8 — CID 87193432
bis[(2-nitrophenyl)methyl] piperazine-1,4-dicarboxylate (PubChem CID 87193432) has the molecular formula C20H20N4O8 and a molecular weight of 444.40 g/mol. Its IUPAC name is bis[(2-nitrophenyl)methyl] piperazine-1,4-dicarboxylate.
| Compound Name | bis[(2-nitrophenyl)methyl] piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 87193432 |
| Molecular Formula | C20H20N4O8 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | bis[(2-nitrophenyl)methyl] piperazine-1,4-dicarboxylate |
| SMILES | O=C(OCc1ccccc1[N+](=O)[O-])N1CCN(C(=O)OCc2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H20N4O8/c25-19(31-13-15-5-1-3-7-17(15)23(27)28)21-9-11-22(12-10-21)20(26)32-14-16-6-2-4-8-18(16)24(29)30/h1-8H,9-14H2 |
| InChIKey | BQNVWJKGYTZAGX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 145.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|