About cyanamide;pentane-3-thiol
cyanamide;pentane-3-thiol (PubChem CID 87193608) has the molecular formula C7H16N4S
and a molecular weight of 188.30 g/mol. Its IUPAC name is cyanamide;pentane-3-thiol.
Molecular Properties
| Compound Name | cyanamide;pentane-3-thiol |
| PubChem CID | 87193608 |
| Molecular Formula | C7H16N4S |
| Molecular Weight | 188.30 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | cyanamide;pentane-3-thiol |
| SMILES | CCC(S)CC.N#CN.N#CN |
| InChI | InChI=1S/C5H12S.2CH2N2/c1-3-5(6)4-2;2*2-1-3/h5-6H,3-4H2,1-2H3;2*2H2 |
| InChIKey | WJWNZYPZHQYGLZ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze cyanamide;pentane-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanamide;pentane-3-thiol?
The IUPAC name of cyanamide;pentane-3-thiol (CID 87193608) is cyanamide;pentane-3-thiol.
What is the SMILES notation for cyanamide;pentane-3-thiol?
The canonical SMILES for cyanamide;pentane-3-thiol is CCC(S)CC.N#CN.N#CN.
What is the InChIKey of cyanamide;pentane-3-thiol?
The InChIKey is WJWNZYPZHQYGLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12S.2CH2N2/c1-3-5(6)4-2;2*2-1-3/h5-6H,3-4H2,1-2H3;2*2H2.
What are the key properties of cyanamide;pentane-3-thiol?
cyanamide;pentane-3-thiol has a molecular weight of 188.30 g/mol, XLogP of 0.96, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyanamide;pentane-3-thiol is sourced from PubChem (CID 87193608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).