About 1-benzofuran-3-one;(2-chlorooxybenzoyl)oxycarbonyl 2-chlorooxybenzoate
1-benzofuran-3-one;(2-chlorooxybenzoyl)oxycarbonyl 2-chlorooxybenzoate (PubChem CID 87194188) has the molecular formula C23H14Cl2O9
and a molecular weight of 505.26 g/mol. Its IUPAC name is 1-benzofuran-3-one;(2-chlorooxybenzoyl)oxycarbonyl 2-chlorooxybenzoate.
Molecular Properties
| Compound Name | 1-benzofuran-3-one;(2-chlorooxybenzoyl)oxycarbonyl 2-chlorooxybenzoate |
| PubChem CID | 87194188 |
| Molecular Formula | C23H14Cl2O9 |
| Molecular Weight | 505.26 g/mol |
| Exact Mass | 504.00 |
| IUPAC Name | 1-benzofuran-3-one;(2-chlorooxybenzoyl)oxycarbonyl 2-chlorooxybenzoate |
| SMILES | O=C(OC(=O)c1ccccc1OCl)OC(=O)c1ccccc1OCl.O=C1COc2ccccc21 |
| InChI | InChI=1S/C15H8Cl2O7.C8H6O2/c16-23-11-7-3-1-5-9(11)13(18)21-15(20)22-14(19)10-6-2-4-8-12(10)24-17;9-7-5-10-8-4-2-1-3-6(7)8/h1-8H;1-4H,5H2 |
| InChIKey | FDFVYEVUYDNLAD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 505.26 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-benzofuran-3-one;(2-chlorooxybenzoyl)oxycarbonyl 2-chlorooxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran-3-one;(2-chlorooxybenzoyl)oxycarbonyl 2-chlorooxybenzoate?
The IUPAC name of 1-benzofuran-3-one;(2-chlorooxybenzoyl)oxycarbonyl 2-chlorooxybenzoate (CID 87194188) is 1-benzofuran-3-one;(2-chlorooxybenzoyl)oxycarbonyl 2-chlorooxybenzoate.
What is the SMILES notation for 1-benzofuran-3-one;(2-chlorooxybenzoyl)oxycarbonyl 2-chlorooxybenzoate?
The canonical SMILES for 1-benzofuran-3-one;(2-chlorooxybenzoyl)oxycarbonyl 2-chlorooxybenzoate is O=C(OC(=O)c1ccccc1OCl)OC(=O)c1ccccc1OCl.O=C1COc2ccccc21.
What is the InChIKey of 1-benzofuran-3-one;(2-chlorooxybenzoyl)oxycarbonyl 2-chlorooxybenzoate?
The InChIKey is FDFVYEVUYDNLAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8Cl2O7.C8H6O2/c16-23-11-7-3-1-5-9(11)13(18)21-15(20)22-14(19)10-6-2-4-8-12(10)24-17;9-7-5-10-8-4-2-1-3-6(7)8/h1-8H;1-4H,5H2.
What are the key properties of 1-benzofuran-3-one;(2-chlorooxybenzoyl)oxycarbonyl 2-chlorooxybenzoate?
1-benzofuran-3-one;(2-chlorooxybenzoyl)oxycarbonyl 2-chlorooxybenzoate has a molecular weight of 505.26 g/mol, XLogP of 5.15, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran-3-one;(2-chlorooxybenzoyl)oxycarbonyl 2-chlorooxybenzoate is sourced from PubChem (CID 87194188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).