C50H31BF20OS — CID 87194330
(4-butoxyphenyl)-diphenylsulfanium;tetrakis[difluoro-(2,3,4-trifluorophenyl)methyl]boranuide (PubChem CID 87194330) has the molecular formula C50H31BF20OS and a molecular weight of 1070.64 g/mol. Its IUPAC name is (4-butoxyphenyl)-diphenylsulfanium;tetrakis[difluoro-(2,3,4-trifluorophenyl)methyl]boranuide.
| Compound Name | (4-butoxyphenyl)-diphenylsulfanium;tetrakis[difluoro-(2,3,4-trifluorophenyl)methyl]boranuide |
|---|---|
| PubChem CID | 87194330 |
| Molecular Formula | C50H31BF20OS |
| Molecular Weight | 1070.64 g/mol |
| Exact Mass | 1070.19 |
| IUPAC Name | (4-butoxyphenyl)-diphenylsulfanium;tetrakis[difluoro-(2,3,4-trifluorophenyl)methyl]boranuide |
| SMILES | CCCCOc1ccc([S+](c2ccccc2)c2ccccc2)cc1.Fc1ccc(C(F)(F)[B-](C(F)(F)c2ccc(F)c(F)c2F)(C(F)(F)c2ccc(F)c(F)c2F)C(F)(F)c2ccc(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C28H8BF20.C22H23OS/c30-13-5-1-9(17(34)21(13)38)25(42,43)29(26(44,45)10-2-6-14(31)22(39)18(10)35,27(46,47)11-3-7-15(32)23(40)19(11)36)28(48,49)12-4-8-16(33)24(41)20(12)37;1-2-3-18-23-19-14-16-22(17-15-19)24(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h1-8H;4-17H,2-3,18H2,1H3/q-1;+1 |
| InChIKey | HXQRBWWKHXQWOO-UHFFFAOYSA-N |
| XLogP | 16.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1070.64 |
| LogP ≤ 5 | 16.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|