About 4-[(4-amino-3,3-dimethylbutyl)-diethoxysilyl]oxy-4-methylheptane-1,7-diol
4-[(4-amino-3,3-dimethylbutyl)-diethoxysilyl]oxy-4-methylheptane-1,7-diol (PubChem CID 87195185) has the molecular formula C18H41NO5Si
and a molecular weight of 379.61 g/mol. Its IUPAC name is 4-[(4-amino-3,3-dimethylbutyl)-diethoxysilyl]oxy-4-methylheptane-1,7-diol.
Molecular Properties
| Compound Name | 4-[(4-amino-3,3-dimethylbutyl)-diethoxysilyl]oxy-4-methylheptane-1,7-diol |
| PubChem CID | 87195185 |
| Molecular Formula | C18H41NO5Si |
| Molecular Weight | 379.61 g/mol |
| Exact Mass | 379.28 |
| IUPAC Name | 4-[(4-amino-3,3-dimethylbutyl)-diethoxysilyl]oxy-4-methylheptane-1,7-diol |
| SMILES | CCO[Si](CCC(C)(C)CN)(OCC)OC(C)(CCCO)CCCO |
| InChI | InChI=1S/C18H41NO5Si/c1-6-22-25(23-7-2,15-12-17(3,4)16-19)24-18(5,10-8-13-20)11-9-14-21/h20-21H,6-16,19H2,1-5H3 |
| InChIKey | DPHPFGRBPBDIGP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.61 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-amino-3,3-dimethylbutyl)-diethoxysilyl]oxy-4-methylheptane-1,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-amino-3,3-dimethylbutyl)-diethoxysilyl]oxy-4-methylheptane-1,7-diol?
The IUPAC name of 4-[(4-amino-3,3-dimethylbutyl)-diethoxysilyl]oxy-4-methylheptane-1,7-diol (CID 87195185) is 4-[(4-amino-3,3-dimethylbutyl)-diethoxysilyl]oxy-4-methylheptane-1,7-diol.
What is the SMILES notation for 4-[(4-amino-3,3-dimethylbutyl)-diethoxysilyl]oxy-4-methylheptane-1,7-diol?
The canonical SMILES for 4-[(4-amino-3,3-dimethylbutyl)-diethoxysilyl]oxy-4-methylheptane-1,7-diol is CCO[Si](CCC(C)(C)CN)(OCC)OC(C)(CCCO)CCCO.
What is the InChIKey of 4-[(4-amino-3,3-dimethylbutyl)-diethoxysilyl]oxy-4-methylheptane-1,7-diol?
The InChIKey is DPHPFGRBPBDIGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H41NO5Si/c1-6-22-25(23-7-2,15-12-17(3,4)16-19)24-18(5,10-8-13-20)11-9-14-21/h20-21H,6-16,19H2,1-5H3.
What are the key properties of 4-[(4-amino-3,3-dimethylbutyl)-diethoxysilyl]oxy-4-methylheptane-1,7-diol?
4-[(4-amino-3,3-dimethylbutyl)-diethoxysilyl]oxy-4-methylheptane-1,7-diol has a molecular weight of 379.61 g/mol, XLogP of 2.69, 16 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-amino-3,3-dimethylbutyl)-diethoxysilyl]oxy-4-methylheptane-1,7-diol is sourced from PubChem (CID 87195185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).