C10H24BF4N — CID 87195438
2,3-dimethyloctan-2-ylazanium tetrafluoroborate (PubChem CID 87195438) has the molecular formula C10H24BF4N and a molecular weight of 245.11 g/mol. Its IUPAC name is 2,3-dimethyloctan-2-ylazanium tetrafluoroborate.
| Compound Name | 2,3-dimethyloctan-2-ylazanium tetrafluoroborate |
|---|---|
| PubChem CID | 87195438 |
| Molecular Formula | C10H24BF4N |
| Molecular Weight | 245.11 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 2,3-dimethyloctan-2-ylazanium tetrafluoroborate |
| SMILES | CCCCCC(C)C(C)(C)[NH3+].F[B-](F)(F)F |
| InChI | InChI=1S/C10H23N.BF4/c1-5-6-7-8-9(2)10(3,4)11;2-1(3,4)5/h9H,5-8,11H2,1-4H3;/q;-1/p+1 |
| InChIKey | HNRNQPFTMRQBTC-UHFFFAOYSA-O |
| XLogP | 3.52 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.11 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|