About CID 87195443
CID 87195443 (PubChem CID 87195443) has the molecular formula C10H8AsClFN3
and a molecular weight of 299.57 g/mol.
Molecular Properties
| Compound Name | CID 87195443 |
| PubChem CID | 87195443 |
| Molecular Formula | C10H8AsClFN3 |
| Molecular Weight | 299.57 g/mol |
| Exact Mass | 298.96 |
| IUPAC Name | — |
| SMILES | Fc1cn(C2CCC2)c2nc(Cl)nc([As])c12 |
| InChI | InChI=1S/C10H8AsClFN3/c11-8-7-6(13)4-16(5-2-1-3-5)9(7)15-10(12)14-8/h4-5H,1-3H2 |
| InChIKey | RPKGAEFQXRQCTQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.57 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87195443 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87195443?
The IUPAC name of CID 87195443 (CID 87195443) is not available.
What is the SMILES notation for CID 87195443?
The canonical SMILES for CID 87195443 is Fc1cn(C2CCC2)c2nc(Cl)nc([As])c12.
What is the InChIKey of CID 87195443?
The InChIKey is RPKGAEFQXRQCTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8AsClFN3/c11-8-7-6(13)4-16(5-2-1-3-5)9(7)15-10(12)14-8/h4-5H,1-3H2.
What are the key properties of CID 87195443?
CID 87195443 has a molecular weight of 299.57 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87195443 is sourced from PubChem (CID 87195443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).