C16H18Cl2N2O4 — CID 87195447
methyl (2S,4R)-4-(2-chloro-6-methoxyquinolin-3-yl)oxypyrrolidin-1-ium-2-carboxylate chloride (PubChem CID 87195447) has the molecular formula C16H18Cl2N2O4 and a molecular weight of 373.24 g/mol. Its IUPAC name is methyl (2S,4R)-4-(2-chloro-6-methoxyquinolin-3-yl)oxypyrrolidin-1-ium-2-carboxylate chloride.
| Compound Name | methyl (2S,4R)-4-(2-chloro-6-methoxyquinolin-3-yl)oxypyrrolidin-1-ium-2-carboxylate chloride |
|---|---|
| PubChem CID | 87195447 |
| Molecular Formula | C16H18Cl2N2O4 |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | methyl (2S,4R)-4-(2-chloro-6-methoxyquinolin-3-yl)oxypyrrolidin-1-ium-2-carboxylate chloride |
| SMILES | COC(=O)[C@@H]1C[C@@H](Oc2cc3cc(OC)ccc3nc2Cl)C[NH2+]1.[Cl-] |
| InChI | InChI=1S/C16H17ClN2O4.ClH/c1-21-10-3-4-12-9(5-10)6-14(15(17)19-12)23-11-7-13(18-8-11)16(20)22-2;/h3-6,11,13,18H,7-8H2,1-2H3;1H/t11-,13+;/m1./s1 |
| InChIKey | LPTWPNBVMIKRDC-YLAFAASESA-N |
| XLogP | -1.84 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|