C23H16F3N3O4 — CID 87195508
(2,2,2-trifluoroacetyl) 3-(5-methyl-2-pyridinyl)-5-[(5R)-5-pyridin-2-yl-4,5-dihydro-1,2-oxazol-3-yl]benzoate (PubChem CID 87195508) has the molecular formula C23H16F3N3O4 and a molecular weight of 455.39 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-(5-methyl-2-pyridinyl)-5-[(5R)-5-pyridin-2-yl-4,5-dihydro-1,2-oxazol-3-yl]benzoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-(5-methyl-2-pyridinyl)-5-[(5R)-5-pyridin-2-yl-4,5-dihydro-1,2-oxazol-3-yl]benzoate |
|---|---|
| PubChem CID | 87195508 |
| Molecular Formula | C23H16F3N3O4 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-(5-methyl-2-pyridinyl)-5-[(5R)-5-pyridin-2-yl-4,5-dihydro-1,2-oxazol-3-yl]benzoate |
| SMILES | Cc1ccc(-c2cc(C(=O)OC(=O)C(F)(F)F)cc(C3=NO[C@@H](c4ccccn4)C3)c2)nc1 |
| InChI | InChI=1S/C23H16F3N3O4/c1-13-5-6-17(28-12-13)14-8-15(10-16(9-14)21(30)32-22(31)23(24,25)26)19-11-20(33-29-19)18-4-2-3-7-27-18/h2-10,12,20H,11H2,1H3/t20-/m1/s1 |
| InChIKey | ODBBAPLFQCFTOG-HXUWFJFHSA-N |
| XLogP | 4.56 |
| TPSA | 90.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|