C15H21N3O7S — CID 87195776
1,4-diiminobutane-2-sulfonic acid;4-(2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylic acid (PubChem CID 87195776) has the molecular formula C15H21N3O7S and a molecular weight of 387.41 g/mol. Its IUPAC name is 1,4-diiminobutane-2-sulfonic acid;4-(2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 1,4-diiminobutane-2-sulfonic acid;4-(2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 87195776 |
| Molecular Formula | C15H21N3O7S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 1,4-diiminobutane-2-sulfonic acid;4-(2,5-dioxopyrrol-1-yl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(N2C(=O)C=CC2=O)CC1.[H]/N=C/CC(/C=N/[H])S(=O)(=O)O |
| InChI | InChI=1S/C11H13NO4.C4H8N2O3S/c13-9-5-6-10(14)12(9)8-3-1-7(2-4-8)11(15)16;5-2-1-4(3-6)10(7,8)9/h5-8H,1-4H2,(H,15,16);2-6H,1H2,(H,7,8,9)/b;5-2+,6-3+ |
| InChIKey | OCMVLZRWHFQHQI-WUDGHMFLSA-N |
| XLogP | 0.49 |
| TPSA | 176.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|