C30H29F9N4O — CID 87196539
(2R,4S)-N-[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-morpholin-4-yl-2-pyridinyl]-2-ethyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-amine (PubChem CID 87196539) has the molecular formula C30H29F9N4O and a molecular weight of 632.57 g/mol. Its IUPAC name is (2R,4S)-N-[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-morpholin-4-yl-2-pyridinyl]-2-ethyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-amine.
| Compound Name | (2R,4S)-N-[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-morpholin-4-yl-2-pyridinyl]-2-ethyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-amine |
|---|---|
| PubChem CID | 87196539 |
| Molecular Formula | C30H29F9N4O |
| Molecular Weight | 632.57 g/mol |
| Exact Mass | 632.22 |
| IUPAC Name | (2R,4S)-N-[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-morpholin-4-yl-2-pyridinyl]-2-ethyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-amine |
| SMILES | CC[C@@H]1C[C@H](Nc2ncc(N3CCOCC3)cc2Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)ccc2N1 |
| InChI | InChI=1S/C30H29F9N4O/c1-2-22-15-26(24-14-19(28(31,32)33)3-4-25(24)41-22)42-27-18(12-23(16-40-27)43-5-7-44-8-6-43)9-17-10-20(29(34,35)36)13-21(11-17)30(37,38)39/h3-4,10-14,16,22,26,41H,2,5-9,15H2,1H3,(H,40,42)/t22-,26+/m1/s1 |
| InChIKey | SLOHWUVLDJHBIU-GJZUVCINSA-N |
| XLogP | 8.31 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.57 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |