About 1-adamantylmethyl 2,2-difluoropropanoate;triphenylsulfanium
1-adamantylmethyl 2,2-difluoropropanoate;triphenylsulfanium (PubChem CID 87196667) has the molecular formula C32H35F2O2S+
and a molecular weight of 521.69 g/mol. Its IUPAC name is 1-adamantylmethyl 2,2-difluoropropanoate;triphenylsulfanium.
Molecular Properties
| Compound Name | 1-adamantylmethyl 2,2-difluoropropanoate;triphenylsulfanium |
| PubChem CID | 87196667 |
| Molecular Formula | C32H35F2O2S+ |
| Molecular Weight | 521.69 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | 1-adamantylmethyl 2,2-difluoropropanoate;triphenylsulfanium |
| SMILES | CC(F)(F)C(=O)OCC12CC3CC(CC(C3)C1)C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C14H20F2O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-13(15,16)12(17)18-8-14-5-9-2-10(6-14)4-11(3-9)7-14/h1-15H;9-11H,2-8H2,1H3/q+1; |
| InChIKey | CDBOCRYYKNAEHY-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 521.69 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 1-adamantylmethyl 2,2-difluoropropanoate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantylmethyl 2,2-difluoropropanoate;triphenylsulfanium?
The IUPAC name of 1-adamantylmethyl 2,2-difluoropropanoate;triphenylsulfanium (CID 87196667) is 1-adamantylmethyl 2,2-difluoropropanoate;triphenylsulfanium.
What is the SMILES notation for 1-adamantylmethyl 2,2-difluoropropanoate;triphenylsulfanium?
The canonical SMILES for 1-adamantylmethyl 2,2-difluoropropanoate;triphenylsulfanium is CC(F)(F)C(=O)OCC12CC3CC(CC(C3)C1)C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 1-adamantylmethyl 2,2-difluoropropanoate;triphenylsulfanium?
The InChIKey is CDBOCRYYKNAEHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15S.C14H20F2O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-13(15,16)12(17)18-8-14-5-9-2-10(6-14)4-11(3-9)7-14/h1-15H;9-11H,2-8H2,1H3/q+1;.
What are the key properties of 1-adamantylmethyl 2,2-difluoropropanoate;triphenylsulfanium?
1-adamantylmethyl 2,2-difluoropropanoate;triphenylsulfanium has a molecular weight of 521.69 g/mol, XLogP of 8.18, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantylmethyl 2,2-difluoropropanoate;triphenylsulfanium is sourced from PubChem (CID 87196667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).