About 4-(trifluoromethyl)benzoyl chloride;2-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazole
4-(trifluoromethyl)benzoyl chloride;2-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazole (PubChem CID 87197016) has the molecular formula C18H12ClF6NO2
and a molecular weight of 423.74 g/mol. Its IUPAC name is 4-(trifluoromethyl)benzoyl chloride;2-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazole.
Molecular Properties
| Compound Name | 4-(trifluoromethyl)benzoyl chloride;2-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazole |
| PubChem CID | 87197016 |
| Molecular Formula | C18H12ClF6NO2 |
| Molecular Weight | 423.74 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | 4-(trifluoromethyl)benzoyl chloride;2-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazole |
| SMILES | FC(F)(F)c1ccc(C2=NCCO2)cc1.O=C(Cl)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H8F3NO.C8H4ClF3O/c11-10(12,13)8-3-1-7(2-4-8)9-14-5-6-15-9;9-7(13)5-1-3-6(4-2-5)8(10,11)12/h1-4H,5-6H2;1-4H |
| InChIKey | NNRSDLUTLCWDHA-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.74 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(trifluoromethyl)benzoyl chloride;2-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(trifluoromethyl)benzoyl chloride;2-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazole?
The IUPAC name of 4-(trifluoromethyl)benzoyl chloride;2-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazole (CID 87197016) is 4-(trifluoromethyl)benzoyl chloride;2-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazole.
What is the SMILES notation for 4-(trifluoromethyl)benzoyl chloride;2-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazole?
The canonical SMILES for 4-(trifluoromethyl)benzoyl chloride;2-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazole is FC(F)(F)c1ccc(C2=NCCO2)cc1.O=C(Cl)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of 4-(trifluoromethyl)benzoyl chloride;2-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazole?
The InChIKey is NNRSDLUTLCWDHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3NO.C8H4ClF3O/c11-10(12,13)8-3-1-7(2-4-8)9-14-5-6-15-9;9-7(13)5-1-3-6(4-2-5)8(10,11)12/h1-4H,5-6H2;1-4H.
What are the key properties of 4-(trifluoromethyl)benzoyl chloride;2-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazole?
4-(trifluoromethyl)benzoyl chloride;2-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazole has a molecular weight of 423.74 g/mol, XLogP of 5.57, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(trifluoromethyl)benzoyl chloride;2-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazole is sourced from PubChem (CID 87197016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).