C29H29F9IN3O3 — CID 87197291
ethyl (2R,4S)-2-amino-4-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(iodomethyl)-5,6-dihydro-1,3-oxazin-2-yl]-2-ethyl-6-(trifluoromethyl)-3,4-dihydroquinoline-1-carboxylate (PubChem CID 87197291) has the molecular formula C29H29F9IN3O3 and a molecular weight of 765.45 g/mol. Its IUPAC name is ethyl (2R,4S)-2-amino-4-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(iodomethyl)-5,6-dihydro-1,3-oxazin-2-yl]-2-ethyl-6-(trifluoromethyl)-3,4-dihydroquinoline-1-carboxylate.
| Compound Name | ethyl (2R,4S)-2-amino-4-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(iodomethyl)-5,6-dihydro-1,3-oxazin-2-yl]-2-ethyl-6-(trifluoromethyl)-3,4-dihydroquinoline-1-carboxylate |
|---|---|
| PubChem CID | 87197291 |
| Molecular Formula | C29H29F9IN3O3 |
| Molecular Weight | 765.45 g/mol |
| Exact Mass | 765.11 |
| IUPAC Name | ethyl (2R,4S)-2-amino-4-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(iodomethyl)-5,6-dihydro-1,3-oxazin-2-yl]-2-ethyl-6-(trifluoromethyl)-3,4-dihydroquinoline-1-carboxylate |
| SMILES | CCOC(=O)N1c2ccc(C(F)(F)F)cc2[C@@H](C2=NC(CI)(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)CCO2)C[C@@]1(N)CC |
| InChI | InChI=1S/C29H29F9IN3O3/c1-3-26(40)14-21(20-12-17(27(30,31)32)5-6-22(20)42(26)24(43)44-4-2)23-41-25(15-39,7-8-45-23)13-16-9-18(28(33,34)35)11-19(10-16)29(36,37)38/h5-6,9-12,21H,3-4,7-8,13-15,40H2,1-2H3/t21-,25?,26+/m0/s1 |
| InChIKey | QZRMBPKDVNTKFE-PYOKFVPOSA-N |
| XLogP | 8.49 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.45 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|