About amino 2-aminoacetate;zinc
amino 2-aminoacetate;zinc (PubChem CID 87197519) has the molecular formula C2H6N2O2Zn
and a molecular weight of 155.47 g/mol. Its IUPAC name is amino 2-aminoacetate;zinc.
Molecular Properties
| Compound Name | amino 2-aminoacetate;zinc |
| PubChem CID | 87197519 |
| Molecular Formula | C2H6N2O2Zn |
| Molecular Weight | 155.47 g/mol |
| Exact Mass | 153.97 |
| IUPAC Name | amino 2-aminoacetate;zinc |
| SMILES | NCC(=O)ON.[Zn] |
| InChI | InChI=1S/C2H6N2O2.Zn/c3-1-2(5)6-4;/h1,3-4H2; |
| InChIKey | MXAJBDKBJJDSBF-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.47 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino 2-aminoacetate;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino 2-aminoacetate;zinc?
The IUPAC name of amino 2-aminoacetate;zinc (CID 87197519) is amino 2-aminoacetate;zinc.
What is the SMILES notation for amino 2-aminoacetate;zinc?
The canonical SMILES for amino 2-aminoacetate;zinc is NCC(=O)ON.[Zn].
What is the InChIKey of amino 2-aminoacetate;zinc?
The InChIKey is MXAJBDKBJJDSBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O2.Zn/c3-1-2(5)6-4;/h1,3-4H2;.
What are the key properties of amino 2-aminoacetate;zinc?
amino 2-aminoacetate;zinc has a molecular weight of 155.47 g/mol, XLogP of -1.64, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino 2-aminoacetate;zinc is sourced from PubChem (CID 87197519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).