amino 2-aminoacetate;zinc

C2H6N2O2Zn — CID 87197519

IUPACamino 2-aminoacetate;zinc
SMILESNCC(=O)ON.[Zn]
InChIInChI=1S/C2H6N2O2.Zn/c3-1-2(5)6-4;/h1,3-4H2;
InChIKeyMXAJBDKBJJDSBF-UHFFFAOYSA-N
MW155.47 g/mol
LogP-1.64
Rot. Bonds1

About amino 2-aminoacetate;zinc

amino 2-aminoacetate;zinc (PubChem CID 87197519) has the molecular formula C2H6N2O2Zn and a molecular weight of 155.47 g/mol. Its IUPAC name is amino 2-aminoacetate;zinc.

Molecular Properties

Compound Nameamino 2-aminoacetate;zinc
PubChem CID87197519
Molecular FormulaC2H6N2O2Zn
Molecular Weight155.47 g/mol
Exact Mass153.97
IUPAC Nameamino 2-aminoacetate;zinc
SMILESNCC(=O)ON.[Zn]
InChIInChI=1S/C2H6N2O2.Zn/c3-1-2(5)6-4;/h1,3-4H2;
InChIKeyMXAJBDKBJJDSBF-UHFFFAOYSA-N
XLogP-1.64
TPSA78.34 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500155.47
LogP ≤ 5-1.64
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze amino 2-aminoacetate;zinc with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of amino 2-aminoacetate;zinc?
The IUPAC name of amino 2-aminoacetate;zinc (CID 87197519) is amino 2-aminoacetate;zinc.
What is the SMILES notation for amino 2-aminoacetate;zinc?
The canonical SMILES for amino 2-aminoacetate;zinc is NCC(=O)ON.[Zn].
What is the InChIKey of amino 2-aminoacetate;zinc?
The InChIKey is MXAJBDKBJJDSBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O2.Zn/c3-1-2(5)6-4;/h1,3-4H2;.
What are the key properties of amino 2-aminoacetate;zinc?
amino 2-aminoacetate;zinc has a molecular weight of 155.47 g/mol, XLogP of -1.64, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino 2-aminoacetate;zinc is sourced from PubChem (CID 87197519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).