About (E)-1,1,3,4-tetrachlorobut-3-en-2-one
(E)-1,1,3,4-tetrachlorobut-3-en-2-one (PubChem CID 87197692) has the molecular formula C4H2Cl4O
and a molecular weight of 207.87 g/mol. Its IUPAC name is (E)-1,1,3,4-tetrachlorobut-3-en-2-one.
Molecular Properties
| Compound Name | (E)-1,1,3,4-tetrachlorobut-3-en-2-one |
| PubChem CID | 87197692 |
| Molecular Formula | C4H2Cl4O |
| Molecular Weight | 207.87 g/mol |
| Exact Mass | 205.89 |
| IUPAC Name | (E)-1,1,3,4-tetrachlorobut-3-en-2-one |
| SMILES | O=C(/C(Cl)=C\Cl)C(Cl)Cl |
| InChI | InChI=1S/C4H2Cl4O/c5-1-2(6)3(9)4(7)8/h1,4H/b2-1+ |
| InChIKey | HKQHPCDHDWSONI-OWOJBTEDSA-N |
| XLogP | 2.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.87 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,1,3,4-tetrachlorobut-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,1,3,4-tetrachlorobut-3-en-2-one?
The IUPAC name of (E)-1,1,3,4-tetrachlorobut-3-en-2-one (CID 87197692) is (E)-1,1,3,4-tetrachlorobut-3-en-2-one.
What is the SMILES notation for (E)-1,1,3,4-tetrachlorobut-3-en-2-one?
The canonical SMILES for (E)-1,1,3,4-tetrachlorobut-3-en-2-one is O=C(/C(Cl)=C\Cl)C(Cl)Cl.
What is the InChIKey of (E)-1,1,3,4-tetrachlorobut-3-en-2-one?
The InChIKey is HKQHPCDHDWSONI-OWOJBTEDSA-N. The full InChI is InChI=1S/C4H2Cl4O/c5-1-2(6)3(9)4(7)8/h1,4H/b2-1+.
What are the key properties of (E)-1,1,3,4-tetrachlorobut-3-en-2-one?
(E)-1,1,3,4-tetrachlorobut-3-en-2-one has a molecular weight of 207.87 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,1,3,4-tetrachlorobut-3-en-2-one is sourced from PubChem (CID 87197692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).