C14H10F6O4S2 — CID 87197724
5-[3,4-bis(2,2,2-trifluoroethoxy)thiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 87197724) has the molecular formula C14H10F6O4S2 and a molecular weight of 420.35 g/mol. Its IUPAC name is 5-[3,4-bis(2,2,2-trifluoroethoxy)thiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5-[3,4-bis(2,2,2-trifluoroethoxy)thiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 87197724 |
| Molecular Formula | C14H10F6O4S2 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | 5-[3,4-bis(2,2,2-trifluoroethoxy)thiophen-2-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | FC(F)(F)COc1csc(-c2scc3c2OCCO3)c1OCC(F)(F)F |
| InChI | InChI=1S/C14H10F6O4S2/c15-13(16,17)5-23-8-4-26-12(10(8)24-6-14(18,19)20)11-9-7(3-25-11)21-1-2-22-9/h3-4H,1-2,5-6H2 |
| InChIKey | QMRXHXSFDODCCF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |