C21H22ClN3O4 — CID 87197789
8-(2-chloropyridine-4-carbonyl)-3-[(3-methoxyphenyl)methyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one (PubChem CID 87197789) has the molecular formula C21H22ClN3O4 and a molecular weight of 415.88 g/mol. Its IUPAC name is 8-(2-chloropyridine-4-carbonyl)-3-[(3-methoxyphenyl)methyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 8-(2-chloropyridine-4-carbonyl)-3-[(3-methoxyphenyl)methyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 87197789 |
| Molecular Formula | C21H22ClN3O4 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 8-(2-chloropyridine-4-carbonyl)-3-[(3-methoxyphenyl)methyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
| SMILES | COc1cccc(CN2CC3(CCN(C(=O)c4ccnc(Cl)c4)CC3)OC2=O)c1 |
| InChI | InChI=1S/C21H22ClN3O4/c1-28-17-4-2-3-15(11-17)13-25-14-21(29-20(25)27)6-9-24(10-7-21)19(26)16-5-8-23-18(22)12-16/h2-5,8,11-12H,6-7,9-10,13-14H2,1H3 |
| InChIKey | MXZVFVHAUXFEIZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|