C8H5F7O — CID 87197835
2-(1,1,2,2,3,3,3-heptafluoropropyl)-2H-pyran (PubChem CID 87197835) has the molecular formula C8H5F7O and a molecular weight of 250.11 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropyl)-2H-pyran.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-2H-pyran |
|---|---|
| PubChem CID | 87197835 |
| Molecular Formula | C8H5F7O |
| Molecular Weight | 250.11 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-2H-pyran |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C1C=CC=CO1 |
| InChI | InChI=1S/C8H5F7O/c9-6(10,5-3-1-2-4-16-5)7(11,12)8(13,14)15/h1-5H |
| InChIKey | QZMWHFYXDOZEHZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.11 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|