About azanylidyneazanium;naphthalene;tetrafluoroborate
azanylidyneazanium;naphthalene;tetrafluoroborate (PubChem CID 87197923) has the molecular formula C10H9BF4N2
and a molecular weight of 244.00 g/mol. Its IUPAC name is azanylidyneazanium;naphthalene;tetrafluoroborate.
Molecular Properties
| Compound Name | azanylidyneazanium;naphthalene;tetrafluoroborate |
| PubChem CID | 87197923 |
| Molecular Formula | C10H9BF4N2 |
| Molecular Weight | 244.00 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | azanylidyneazanium;naphthalene;tetrafluoroborate |
| SMILES | F[B-](F)(F)F.N#[NH+].c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.BF4.N2/c1-2-6-10-8-4-3-7-9(10)5-1;2-1(3,4)5;1-2/h1-8H;;/q;-1;/p+1 |
| InChIKey | YBCUJLTVQQYJNP-UHFFFAOYSA-O |
| XLogP | 2.42 |
| TPSA | 47.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.00 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze azanylidyneazanium;naphthalene;tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanylidyneazanium;naphthalene;tetrafluoroborate?
The IUPAC name of azanylidyneazanium;naphthalene;tetrafluoroborate (CID 87197923) is azanylidyneazanium;naphthalene;tetrafluoroborate.
What is the SMILES notation for azanylidyneazanium;naphthalene;tetrafluoroborate?
The canonical SMILES for azanylidyneazanium;naphthalene;tetrafluoroborate is F[B-](F)(F)F.N#[NH+].c1ccc2ccccc2c1.
What is the InChIKey of azanylidyneazanium;naphthalene;tetrafluoroborate?
The InChIKey is YBCUJLTVQQYJNP-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H8.BF4.N2/c1-2-6-10-8-4-3-7-9(10)5-1;2-1(3,4)5;1-2/h1-8H;;/q;-1;/p+1.
What are the key properties of azanylidyneazanium;naphthalene;tetrafluoroborate?
azanylidyneazanium;naphthalene;tetrafluoroborate has a molecular weight of 244.00 g/mol, XLogP of 2.42, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azanylidyneazanium;naphthalene;tetrafluoroborate is sourced from PubChem (CID 87197923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).