About 2,2,2-trifluoro-1-[tris(2-methylpropyl)silyl]ethanone;hydrate
2,2,2-trifluoro-1-[tris(2-methylpropyl)silyl]ethanone;hydrate (PubChem CID 87197970) has the molecular formula C14H29F3O2Si
and a molecular weight of 314.46 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[tris(2-methylpropyl)silyl]ethanone;hydrate.
Molecular Properties
| Compound Name | 2,2,2-trifluoro-1-[tris(2-methylpropyl)silyl]ethanone;hydrate |
| PubChem CID | 87197970 |
| Molecular Formula | C14H29F3O2Si |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 2,2,2-trifluoro-1-[tris(2-methylpropyl)silyl]ethanone;hydrate |
| SMILES | CC(C)C[Si](CC(C)C)(CC(C)C)C(=O)C(F)(F)F.O |
| InChI | InChI=1S/C14H27F3OSi.H2O/c1-10(2)7-19(8-11(3)4,9-12(5)6)13(18)14(15,16)17;/h10-12H,7-9H2,1-6H3;1H2 |
| InChIKey | JZJYVTXPROQXNI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 48.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trifluoro-1-[tris(2-methylpropyl)silyl]ethanone;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoro-1-[tris(2-methylpropyl)silyl]ethanone;hydrate?
The IUPAC name of 2,2,2-trifluoro-1-[tris(2-methylpropyl)silyl]ethanone;hydrate (CID 87197970) is 2,2,2-trifluoro-1-[tris(2-methylpropyl)silyl]ethanone;hydrate.
What is the SMILES notation for 2,2,2-trifluoro-1-[tris(2-methylpropyl)silyl]ethanone;hydrate?
The canonical SMILES for 2,2,2-trifluoro-1-[tris(2-methylpropyl)silyl]ethanone;hydrate is CC(C)C[Si](CC(C)C)(CC(C)C)C(=O)C(F)(F)F.O.
What is the InChIKey of 2,2,2-trifluoro-1-[tris(2-methylpropyl)silyl]ethanone;hydrate?
The InChIKey is JZJYVTXPROQXNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27F3OSi.H2O/c1-10(2)7-19(8-11(3)4,9-12(5)6)13(18)14(15,16)17;/h10-12H,7-9H2,1-6H3;1H2.
What are the key properties of 2,2,2-trifluoro-1-[tris(2-methylpropyl)silyl]ethanone;hydrate?
2,2,2-trifluoro-1-[tris(2-methylpropyl)silyl]ethanone;hydrate has a molecular weight of 314.46 g/mol, XLogP of 4.25, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoro-1-[tris(2-methylpropyl)silyl]ethanone;hydrate is sourced from PubChem (CID 87197970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).