C23H21ClN4O10S3 — CID 87198058
2-[4-[[4-chloro-5-[(1,3-dioxoinden-2-ylidene)methyl]-1,3-thiazol-2-yl]diazenyl]-N-ethylanilino]ethyl hydrogen sulfate;sulfuric acid (PubChem CID 87198058) has the molecular formula C23H21ClN4O10S3 and a molecular weight of 645.09 g/mol. Its IUPAC name is 2-[4-[[4-chloro-5-[(1,3-dioxoinden-2-ylidene)methyl]-1,3-thiazol-2-yl]diazenyl]-N-ethylanilino]ethyl hydrogen sulfate;sulfuric acid.
| Compound Name | 2-[4-[[4-chloro-5-[(1,3-dioxoinden-2-ylidene)methyl]-1,3-thiazol-2-yl]diazenyl]-N-ethylanilino]ethyl hydrogen sulfate;sulfuric acid |
|---|---|
| PubChem CID | 87198058 |
| Molecular Formula | C23H21ClN4O10S3 |
| Molecular Weight | 645.09 g/mol |
| Exact Mass | 644.01 |
| IUPAC Name | 2-[4-[[4-chloro-5-[(1,3-dioxoinden-2-ylidene)methyl]-1,3-thiazol-2-yl]diazenyl]-N-ethylanilino]ethyl hydrogen sulfate;sulfuric acid |
| SMILES | CCN(CCOS(=O)(=O)O)c1ccc(/N=N/c2nc(Cl)c(C=C3C(=O)c4ccccc4C3=O)s2)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C23H19ClN4O6S2.H2O4S/c1-2-28(11-12-34-36(31,32)33)15-9-7-14(8-10-15)26-27-23-25-22(24)19(35-23)13-18-20(29)16-5-3-4-6-17(16)21(18)30;1-5(2,3)4/h3-10,13H,2,11-12H2,1H3,(H,31,32,33);(H2,1,2,3,4)/b27-26+; |
| InChIKey | YUDMCBCYQCWYCO-JGUILPGDSA-N |
| XLogP | 4.67 |
| TPSA | 213.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.09 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|