C26H39Cl2F3N2O5SSi — CID 87198234
[3,5-dichloro-4-[(R)-(2-oxopyrrolidin-3-yl)-[4-tri(propan-2-yl)silyloxypiperidin-1-yl]methyl]phenyl] trifluoromethanesulfonate (PubChem CID 87198234) has the molecular formula C26H39Cl2F3N2O5SSi and a molecular weight of 647.66 g/mol. Its IUPAC name is [3,5-dichloro-4-[(R)-(2-oxopyrrolidin-3-yl)-[4-tri(propan-2-yl)silyloxypiperidin-1-yl]methyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3,5-dichloro-4-[(R)-(2-oxopyrrolidin-3-yl)-[4-tri(propan-2-yl)silyloxypiperidin-1-yl]methyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87198234 |
| Molecular Formula | C26H39Cl2F3N2O5SSi |
| Molecular Weight | 647.66 g/mol |
| Exact Mass | 646.17 |
| IUPAC Name | [3,5-dichloro-4-[(R)-(2-oxopyrrolidin-3-yl)-[4-tri(propan-2-yl)silyloxypiperidin-1-yl]methyl]phenyl] trifluoromethanesulfonate |
| SMILES | CC(C)[Si](OC1CCN([C@@H](c2c(Cl)cc(OS(=O)(=O)C(F)(F)F)cc2Cl)C2CCNC2=O)CC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H39Cl2F3N2O5SSi/c1-15(2)40(16(3)4,17(5)6)38-18-8-11-33(12-9-18)24(20-7-10-32-25(20)34)23-21(27)13-19(14-22(23)28)37-39(35,36)26(29,30)31/h13-18,20,24H,7-12H2,1-6H3,(H,32,34)/t20?,24-/m1/s1 |
| InChIKey | ZZNGLEPPXRBDKA-PIFIWZBESA-N |
| XLogP | 7.06 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.66 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|