C20H22F6N2O5 — CID 87198450
2-[5-[[6-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-propyl-3-pyridinyl]oxy]-1-oxidopyridin-1-ium-2-yl]ethanol (PubChem CID 87198450) has the molecular formula C20H22F6N2O5 and a molecular weight of 484.39 g/mol. Its IUPAC name is 2-[5-[[6-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-propyl-3-pyridinyl]oxy]-1-oxidopyridin-1-ium-2-yl]ethanol.
| Compound Name | 2-[5-[[6-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-propyl-3-pyridinyl]oxy]-1-oxidopyridin-1-ium-2-yl]ethanol |
|---|---|
| PubChem CID | 87198450 |
| Molecular Formula | C20H22F6N2O5 |
| Molecular Weight | 484.39 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 2-[5-[[6-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-propyl-3-pyridinyl]oxy]-1-oxidopyridin-1-ium-2-yl]ethanol |
| SMILES | CCCc1nc(C(OCOC)(C(F)(F)F)C(F)(F)F)ccc1Oc1ccc(CCO)[n+]([O-])c1 |
| InChI | InChI=1S/C20H22F6N2O5/c1-3-4-15-16(33-14-6-5-13(9-10-29)28(30)11-14)7-8-17(27-15)18(19(21,22)23,20(24,25)26)32-12-31-2/h5-8,11,29H,3-4,9-10,12H2,1-2H3 |
| InChIKey | JKRGOCBNMJLVJF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 87.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|