About N-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide
N-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide (PubChem CID 87198521) has the molecular formula C9H8FN3O2S2
and a molecular weight of 273.31 g/mol. Its IUPAC name is N-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
| PubChem CID | 87198521 |
| Molecular Formula | C9H8FN3O2S2 |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | N-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
| SMILES | Cc1nnc(N(F)S(=O)(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C9H8FN3O2S2/c1-7-11-12-9(16-7)13(10)17(14,15)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | PVPDXYLTJIADFD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide?
The IUPAC name of N-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide (CID 87198521) is N-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide.
What is the SMILES notation for N-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide?
The canonical SMILES for N-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide is Cc1nnc(N(F)S(=O)(=O)c2ccccc2)s1.
What is the InChIKey of N-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide?
The InChIKey is PVPDXYLTJIADFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FN3O2S2/c1-7-11-12-9(16-7)13(10)17(14,15)8-5-3-2-4-6-8/h2-6H,1H3.
What are the key properties of N-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide?
N-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide has a molecular weight of 273.31 g/mol, XLogP of 1.93, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide is sourced from PubChem (CID 87198521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).