C13H14F13NOS — CID 87198670
N-methyl-N-[1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)ethyl]acetamide (PubChem CID 87198670) has the molecular formula C13H14F13NOS and a molecular weight of 479.30 g/mol. Its IUPAC name is N-methyl-N-[1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)ethyl]acetamide.
| Compound Name | N-methyl-N-[1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 87198670 |
| Molecular Formula | C13H14F13NOS |
| Molecular Weight | 479.30 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | N-methyl-N-[1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)ethyl]acetamide |
| SMILES | CC(=O)N(C)C(C)SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H14F13NOS/c1-6(28)27(3)7(2)29-5-4-8(14,15)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h7H,4-5H2,1-3H3 |
| InChIKey | NYXXLPVSPHJMJD-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.30 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|