C24H15F4NO5S2 — CID 87199009
4-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl-(3-formyl-1-benzothiophen-2-yl)sulfamoyl]benzoic acid (PubChem CID 87199009) has the molecular formula C24H15F4NO5S2 and a molecular weight of 537.51 g/mol. Its IUPAC name is 4-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl-(3-formyl-1-benzothiophen-2-yl)sulfamoyl]benzoic acid.
| Compound Name | 4-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl-(3-formyl-1-benzothiophen-2-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 87199009 |
| Molecular Formula | C24H15F4NO5S2 |
| Molecular Weight | 537.51 g/mol |
| Exact Mass | 537.03 |
| IUPAC Name | 4-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl-(3-formyl-1-benzothiophen-2-yl)sulfamoyl]benzoic acid |
| SMILES | O=Cc1c(N(Cc2ccc(F)c(C(F)(F)F)c2)S(=O)(=O)c2ccc(C(=O)O)cc2)sc2ccccc12 |
| InChI | InChI=1S/C24H15F4NO5S2/c25-20-10-5-14(11-19(20)24(26,27)28)12-29(22-18(13-30)17-3-1-2-4-21(17)35-22)36(33,34)16-8-6-15(7-9-16)23(31)32/h1-11,13H,12H2,(H,31,32) |
| InChIKey | LCUQPVOJPCUESN-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.51 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|