C16H17F6NO2S2 — CID 87199073
2,2,2-trifluoro-N-(3-methyl-1-benzothiophen-2-yl)-N-(5,5,5-trifluoropentyl)ethanesulfonamide (PubChem CID 87199073) has the molecular formula C16H17F6NO2S2 and a molecular weight of 433.44 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(3-methyl-1-benzothiophen-2-yl)-N-(5,5,5-trifluoropentyl)ethanesulfonamide.
| Compound Name | 2,2,2-trifluoro-N-(3-methyl-1-benzothiophen-2-yl)-N-(5,5,5-trifluoropentyl)ethanesulfonamide |
|---|---|
| PubChem CID | 87199073 |
| Molecular Formula | C16H17F6NO2S2 |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | 2,2,2-trifluoro-N-(3-methyl-1-benzothiophen-2-yl)-N-(5,5,5-trifluoropentyl)ethanesulfonamide |
| SMILES | Cc1c(N(CCCCC(F)(F)F)S(=O)(=O)CC(F)(F)F)sc2ccccc12 |
| InChI | InChI=1S/C16H17F6NO2S2/c1-11-12-6-2-3-7-13(12)26-14(11)23(9-5-4-8-15(17,18)19)27(24,25)10-16(20,21)22/h2-3,6-7H,4-5,8-10H2,1H3 |
| InChIKey | QPQCZPUEFGXBQU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|