C18H18FNO2 — CID 87199451
(2S,5R)-5-[4-[(2-fluorophenyl)methoxy]phenyl]pyrrolidine-2-carbaldehyde (PubChem CID 87199451) has the molecular formula C18H18FNO2 and a molecular weight of 299.34 g/mol. Its IUPAC name is (2S,5R)-5-[4-[(2-fluorophenyl)methoxy]phenyl]pyrrolidine-2-carbaldehyde.
| Compound Name | (2S,5R)-5-[4-[(2-fluorophenyl)methoxy]phenyl]pyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 87199451 |
| Molecular Formula | C18H18FNO2 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (2S,5R)-5-[4-[(2-fluorophenyl)methoxy]phenyl]pyrrolidine-2-carbaldehyde |
| SMILES | O=C[C@@H]1CC[C@H](c2ccc(OCc3ccccc3F)cc2)N1 |
| InChI | InChI=1S/C18H18FNO2/c19-17-4-2-1-3-14(17)12-22-16-8-5-13(6-9-16)18-10-7-15(11-21)20-18/h1-6,8-9,11,15,18,20H,7,10,12H2/t15-,18+/m0/s1 |
| InChIKey | KEOHNGZGXVIBDK-MAUKXSAKSA-N |
| XLogP | 3.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|