About 2-bromo-5-butoxypyridine
2-bromo-5-butoxypyridine (PubChem CID 87199523) has the molecular formula C9H12BrNO
and a molecular weight of 230.10 g/mol. Its IUPAC name is 2-bromo-5-butoxypyridine.
Molecular Properties
| Compound Name | 2-bromo-5-butoxypyridine |
| PubChem CID | 87199523 |
| Molecular Formula | C9H12BrNO |
| Molecular Weight | 230.10 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 2-bromo-5-butoxypyridine |
| SMILES | CCCCOc1ccc(Br)nc1 |
| InChI | InChI=1S/C9H12BrNO/c1-2-3-6-12-8-4-5-9(10)11-7-8/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | XNOZIGCXKARPGE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.10 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-butoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-butoxypyridine?
The IUPAC name of 2-bromo-5-butoxypyridine (CID 87199523) is 2-bromo-5-butoxypyridine.
What is the SMILES notation for 2-bromo-5-butoxypyridine?
The canonical SMILES for 2-bromo-5-butoxypyridine is CCCCOc1ccc(Br)nc1.
What is the InChIKey of 2-bromo-5-butoxypyridine?
The InChIKey is XNOZIGCXKARPGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrNO/c1-2-3-6-12-8-4-5-9(10)11-7-8/h4-5,7H,2-3,6H2,1H3.
What are the key properties of 2-bromo-5-butoxypyridine?
2-bromo-5-butoxypyridine has a molecular weight of 230.10 g/mol, XLogP of 3.02, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-butoxypyridine is sourced from PubChem (CID 87199523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).