C31H45N2O6S+ — CID 87200014
[2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-dimethyl-(3-methyl-3-phenoxybutyl)azanium;methanesulfonic acid (PubChem CID 87200014) has the molecular formula C31H45N2O6S+ and a molecular weight of 573.78 g/mol. Its IUPAC name is [2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-dimethyl-(3-methyl-3-phenoxybutyl)azanium;methanesulfonic acid.
| Compound Name | [2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-dimethyl-(3-methyl-3-phenoxybutyl)azanium;methanesulfonic acid |
|---|---|
| PubChem CID | 87200014 |
| Molecular Formula | C31H45N2O6S+ |
| Molecular Weight | 573.78 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | [2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-dimethyl-(3-methyl-3-phenoxybutyl)azanium;methanesulfonic acid |
| SMILES | CC(C)(CC[N+](C)(C)Cc1cnc(C(O)(c2ccccc2)C2CCCCC2)o1)Oc1ccccc1.CS(=O)(=O)O |
| InChI | InChI=1S/C30H41N2O3.CH4O3S/c1-29(2,35-26-18-12-7-13-19-26)20-21-32(3,4)23-27-22-31-28(34-27)30(33,24-14-8-5-9-15-24)25-16-10-6-11-17-25;1-5(2,3)4/h5,7-9,12-15,18-19,22,25,33H,6,10-11,16-17,20-21,23H2,1-4H3;1H3,(H,2,3,4)/q+1; |
| InChIKey | HJWDXULWMIUNGL-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.78 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|