About (Z)-2,4,6-trichlorohex-2-ene-1-thiol
(Z)-2,4,6-trichlorohex-2-ene-1-thiol (PubChem CID 87200060) has the molecular formula C6H9Cl3S
and a molecular weight of 219.56 g/mol. Its IUPAC name is (Z)-2,4,6-trichlorohex-2-ene-1-thiol.
Molecular Properties
| Compound Name | (Z)-2,4,6-trichlorohex-2-ene-1-thiol |
| PubChem CID | 87200060 |
| Molecular Formula | C6H9Cl3S |
| Molecular Weight | 219.56 g/mol |
| Exact Mass | 217.95 |
| IUPAC Name | (Z)-2,4,6-trichlorohex-2-ene-1-thiol |
| SMILES | SC/C(Cl)=C/C(Cl)CCCl |
| InChI | InChI=1S/C6H9Cl3S/c7-2-1-5(8)3-6(9)4-10/h3,5,10H,1-2,4H2/b6-3- |
| InChIKey | JOSRQVOPMOMLKO-UTCJRWHESA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,4,6-trichlorohex-2-ene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,4,6-trichlorohex-2-ene-1-thiol?
The IUPAC name of (Z)-2,4,6-trichlorohex-2-ene-1-thiol (CID 87200060) is (Z)-2,4,6-trichlorohex-2-ene-1-thiol.
What is the SMILES notation for (Z)-2,4,6-trichlorohex-2-ene-1-thiol?
The canonical SMILES for (Z)-2,4,6-trichlorohex-2-ene-1-thiol is SC/C(Cl)=C/C(Cl)CCCl.
What is the InChIKey of (Z)-2,4,6-trichlorohex-2-ene-1-thiol?
The InChIKey is JOSRQVOPMOMLKO-UTCJRWHESA-N. The full InChI is InChI=1S/C6H9Cl3S/c7-2-1-5(8)3-6(9)4-10/h3,5,10H,1-2,4H2/b6-3-.
What are the key properties of (Z)-2,4,6-trichlorohex-2-ene-1-thiol?
(Z)-2,4,6-trichlorohex-2-ene-1-thiol has a molecular weight of 219.56 g/mol, XLogP of 3.28, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,4,6-trichlorohex-2-ene-1-thiol is sourced from PubChem (CID 87200060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).