C35H45N2O6S+ — CID 87200116
[2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenoxypropyl)azanium;4-methylbenzenesulfonic acid (PubChem CID 87200116) has the molecular formula C35H45N2O6S+ and a molecular weight of 621.82 g/mol. Its IUPAC name is [2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenoxypropyl)azanium;4-methylbenzenesulfonic acid.
| Compound Name | [2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenoxypropyl)azanium;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87200116 |
| Molecular Formula | C35H45N2O6S+ |
| Molecular Weight | 621.82 g/mol |
| Exact Mass | 621.30 |
| IUPAC Name | [2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenoxypropyl)azanium;4-methylbenzenesulfonic acid |
| SMILES | C[N+](C)(CCCOc1ccccc1)Cc1cnc(C(O)(c2ccccc2)C2CCCCC2)o1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C28H37N2O3.C7H8O3S/c1-30(2,19-12-20-32-25-17-10-5-11-18-25)22-26-21-29-27(33-26)28(31,23-13-6-3-7-14-23)24-15-8-4-9-16-24;1-6-2-4-7(5-3-6)11(8,9)10/h3,5-7,10-11,13-14,17-18,21,24,31H,4,8-9,12,15-16,19-20,22H2,1-2H3;2-5H,1H3,(H,8,9,10)/q+1; |
| InChIKey | KDYCURRWXVUWNQ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.82 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|