About [3-carboxy-4-(trifluoromethyl)phenyl]-trimethylazanium;trifluoromethanesulfonic acid
[3-carboxy-4-(trifluoromethyl)phenyl]-trimethylazanium;trifluoromethanesulfonic acid (PubChem CID 87200181) has the molecular formula C12H14F6NO5S+
and a molecular weight of 398.30 g/mol. Its IUPAC name is [3-carboxy-4-(trifluoromethyl)phenyl]-trimethylazanium;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | [3-carboxy-4-(trifluoromethyl)phenyl]-trimethylazanium;trifluoromethanesulfonic acid |
| PubChem CID | 87200181 |
| Molecular Formula | C12H14F6NO5S+ |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | [3-carboxy-4-(trifluoromethyl)phenyl]-trimethylazanium;trifluoromethanesulfonic acid |
| SMILES | C[N+](C)(C)c1ccc(C(F)(F)F)c(C(=O)O)c1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C11H12F3NO2.CHF3O3S/c1-15(2,3)7-4-5-9(11(12,13)14)8(6-7)10(16)17;2-1(3,4)8(5,6)7/h4-6H,1-3H3;(H,5,6,7)/p+1 |
| InChIKey | NNKKHKODOZHUMG-UHFFFAOYSA-O |
| XLogP | 2.99 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [3-carboxy-4-(trifluoromethyl)phenyl]-trimethylazanium;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-carboxy-4-(trifluoromethyl)phenyl]-trimethylazanium;trifluoromethanesulfonic acid?
The IUPAC name of [3-carboxy-4-(trifluoromethyl)phenyl]-trimethylazanium;trifluoromethanesulfonic acid (CID 87200181) is [3-carboxy-4-(trifluoromethyl)phenyl]-trimethylazanium;trifluoromethanesulfonic acid.
What is the SMILES notation for [3-carboxy-4-(trifluoromethyl)phenyl]-trimethylazanium;trifluoromethanesulfonic acid?
The canonical SMILES for [3-carboxy-4-(trifluoromethyl)phenyl]-trimethylazanium;trifluoromethanesulfonic acid is C[N+](C)(C)c1ccc(C(F)(F)F)c(C(=O)O)c1.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of [3-carboxy-4-(trifluoromethyl)phenyl]-trimethylazanium;trifluoromethanesulfonic acid?
The InChIKey is NNKKHKODOZHUMG-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H12F3NO2.CHF3O3S/c1-15(2,3)7-4-5-9(11(12,13)14)8(6-7)10(16)17;2-1(3,4)8(5,6)7/h4-6H,1-3H3;(H,5,6,7)/p+1.
What are the key properties of [3-carboxy-4-(trifluoromethyl)phenyl]-trimethylazanium;trifluoromethanesulfonic acid?
[3-carboxy-4-(trifluoromethyl)phenyl]-trimethylazanium;trifluoromethanesulfonic acid has a molecular weight of 398.30 g/mol, XLogP of 2.99, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-carboxy-4-(trifluoromethyl)phenyl]-trimethylazanium;trifluoromethanesulfonic acid is sourced from PubChem (CID 87200181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).