C29H34F4N3O8S2+ — CID 87200222
[2-fluoro-4-[[4-[4-[[(2S)-1-methoxy-3-methyl-1-oxobutan-2-yl]sulfamoyl]phenyl]phenyl]carbamoyl]phenyl]-trimethylazanium;trifluoromethanesulfonic acid (PubChem CID 87200222) has the molecular formula C29H34F4N3O8S2+ and a molecular weight of 692.73 g/mol. Its IUPAC name is [2-fluoro-4-[[4-[4-[[(2S)-1-methoxy-3-methyl-1-oxobutan-2-yl]sulfamoyl]phenyl]phenyl]carbamoyl]phenyl]-trimethylazanium;trifluoromethanesulfonic acid.
| Compound Name | [2-fluoro-4-[[4-[4-[[(2S)-1-methoxy-3-methyl-1-oxobutan-2-yl]sulfamoyl]phenyl]phenyl]carbamoyl]phenyl]-trimethylazanium;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 87200222 |
| Molecular Formula | C29H34F4N3O8S2+ |
| Molecular Weight | 692.73 g/mol |
| Exact Mass | 692.17 |
| IUPAC Name | [2-fluoro-4-[[4-[4-[[(2S)-1-methoxy-3-methyl-1-oxobutan-2-yl]sulfamoyl]phenyl]phenyl]carbamoyl]phenyl]-trimethylazanium;trifluoromethanesulfonic acid |
| SMILES | COC(=O)[C@@H](NS(=O)(=O)c1ccc(-c2ccc(NC(=O)c3ccc([N+](C)(C)C)c(F)c3)cc2)cc1)C(C)C.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C28H32FN3O5S.CHF3O3S/c1-18(2)26(28(34)37-6)31-38(35,36)23-14-9-20(10-15-23)19-7-12-22(13-8-19)30-27(33)21-11-16-25(24(29)17-21)32(3,4)5;2-1(3,4)8(5,6)7/h7-18,26,31H,1-6H3;(H,5,6,7)/p+1/t26-;/m0./s1 |
| InChIKey | RTHQWGAOBGFLDQ-SNYZSRNZSA-O |
| XLogP | 4.81 |
| TPSA | 155.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.73 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|