About 1-ethyl-1-methylpyrrolidin-1-ium;1-propoxybutane-1-sulfonate
1-ethyl-1-methylpyrrolidin-1-ium;1-propoxybutane-1-sulfonate (PubChem CID 87200425) has the molecular formula C14H31NO4S
and a molecular weight of 309.47 g/mol. Its IUPAC name is 1-ethyl-1-methylpyrrolidin-1-ium;1-propoxybutane-1-sulfonate.
Molecular Properties
| Compound Name | 1-ethyl-1-methylpyrrolidin-1-ium;1-propoxybutane-1-sulfonate |
| PubChem CID | 87200425 |
| Molecular Formula | C14H31NO4S |
| Molecular Weight | 309.47 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 1-ethyl-1-methylpyrrolidin-1-ium;1-propoxybutane-1-sulfonate |
| SMILES | CCCOC(CCC)S(=O)(=O)[O-].CC[N+]1(C)CCCC1 |
| InChI | InChI=1S/C7H16N.C7H16O4S/c1-3-8(2)6-4-5-7-8;1-3-5-7(11-6-4-2)12(8,9)10/h3-7H2,1-2H3;7H,3-6H2,1-2H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | NOGSNLAYQMIGOV-UHFFFAOYSA-M |
| XLogP | 2.33 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-1-methylpyrrolidin-1-ium;1-propoxybutane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1-methylpyrrolidin-1-ium;1-propoxybutane-1-sulfonate?
The IUPAC name of 1-ethyl-1-methylpyrrolidin-1-ium;1-propoxybutane-1-sulfonate (CID 87200425) is 1-ethyl-1-methylpyrrolidin-1-ium;1-propoxybutane-1-sulfonate.
What is the SMILES notation for 1-ethyl-1-methylpyrrolidin-1-ium;1-propoxybutane-1-sulfonate?
The canonical SMILES for 1-ethyl-1-methylpyrrolidin-1-ium;1-propoxybutane-1-sulfonate is CCCOC(CCC)S(=O)(=O)[O-].CC[N+]1(C)CCCC1.
What is the InChIKey of 1-ethyl-1-methylpyrrolidin-1-ium;1-propoxybutane-1-sulfonate?
The InChIKey is NOGSNLAYQMIGOV-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H16N.C7H16O4S/c1-3-8(2)6-4-5-7-8;1-3-5-7(11-6-4-2)12(8,9)10/h3-7H2,1-2H3;7H,3-6H2,1-2H3,(H,8,9,10)/q+1;/p-1.
What are the key properties of 1-ethyl-1-methylpyrrolidin-1-ium;1-propoxybutane-1-sulfonate?
1-ethyl-1-methylpyrrolidin-1-ium;1-propoxybutane-1-sulfonate has a molecular weight of 309.47 g/mol, XLogP of 2.33, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1-methylpyrrolidin-1-ium;1-propoxybutane-1-sulfonate is sourced from PubChem (CID 87200425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).