C16H14Cl3N2O2+ — CID 87200629
2,6-dichloro-4-[2-[(4-chlorophenyl)methyl]-2-methyl-5H-1,2,4-oxadiazol-2-ium-5-yl]phenol (PubChem CID 87200629) has the molecular formula C16H14Cl3N2O2+ and a molecular weight of 372.66 g/mol. Its IUPAC name is 2,6-dichloro-4-[2-[(4-chlorophenyl)methyl]-2-methyl-5H-1,2,4-oxadiazol-2-ium-5-yl]phenol.
| Compound Name | 2,6-dichloro-4-[2-[(4-chlorophenyl)methyl]-2-methyl-5H-1,2,4-oxadiazol-2-ium-5-yl]phenol |
|---|---|
| PubChem CID | 87200629 |
| Molecular Formula | C16H14Cl3N2O2+ |
| Molecular Weight | 372.66 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 2,6-dichloro-4-[2-[(4-chlorophenyl)methyl]-2-methyl-5H-1,2,4-oxadiazol-2-ium-5-yl]phenol |
| SMILES | C[N+]1(Cc2ccc(Cl)cc2)C=NC(c2cc(Cl)c(O)c(Cl)c2)O1 |
| InChI | InChI=1S/C16H13Cl3N2O2/c1-21(8-10-2-4-12(17)5-3-10)9-20-16(23-21)11-6-13(18)15(22)14(19)7-11/h2-7,9,16H,8H2,1H3/p+1 |
| InChIKey | NYLVQRUWZLINFZ-UHFFFAOYSA-O |
| XLogP | 4.97 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.66 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|